| Product Name | S-Ethyl thiopropionate |
| CAS No. | 2432-42-0 |
| Synonyms | Thiopropionic acid S-ethyl ester; S-ethyl propanethioate |
| InChI | InChI=1/C5H10OS/c1-3-5(6)7-4-2/h3-4H2,1-2H3 |
| Molecular Formula | C5H10OS |
| Molecular Weight | 118.1973 |
| Density | 0.967g/cm3 |
| Boiling point | 141.4°C at 760 mmHg |
| Flash point | 36°C |
| Refractive index | 1.456 |
| Risk Codes | R10:Flammable.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S23:Do not inhale gas/fumes/vapour/spray.; S24/25:Avoid contact with skin and eyes.; |
2432-42-0 s-ethyl thiopropionate
service@apichina.com