| Product Name | (S)-(-)-ethyl-3-hydroxy 3-phenylpropionate |
| CAS No. | 33401-74-0 |
| Synonyms | (-)-Ethyl (S)-3-hydroxy-3-phenylpropionate; (S)-Ethyl 3-Hydroxy-3-phenylpropanoate; ethyl (3S)-3-hydroxy-3-phenylpropanoate; Ethyl(S)-(-)-3-hydroxy-3-phenylpropionate |
| InChI | InChI=1/C11H14O3/c1-2-14-11(13)8-10(12)9-6-4-3-5-7-9/h3-7,10,12H,2,8H2,1H3/t10-/m0/s1 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.2271 |
| Density | 1.119g/cm3 |
| Boiling point | 315.3°C at 760 mmHg |
| Flash point | 132.6°C |
| Refractive index | 1.523 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
33401-74-0 (s)-(-)-ethyl-3-hydroxy 3-phenylpropionate
service@apichina.com