| Product Name | S-acetylmercaptosuccinic anhydride |
| CAS No. | 6953-60-2 |
| Synonyms | 2-(Acetylthio)succinic anhydride; S-(2,5-dioxotetrahydrofuran-3-yl) ethanethioate; S-[(3S)-2,5-dioxotetrahydrofuran-3-yl] ethanethioate |
| InChI | InChI=1/C6H6O4S/c1-3(7)11-4-2-5(8)10-6(4)9/h4H,2H2,1H3/t4-/m0/s1 |
| Molecular Formula | C6H6O4S |
| Molecular Weight | 174.1744 |
| Density | 1.42g/cm3 |
| Melting point | 83-86℃ |
| Boiling point | 354.3°C at 760 mmHg |
| Flash point | 188.3°C |
| Refractive index | 1.533 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
6953-60-2 s-acetylmercaptosuccinic anhydride
service@apichina.com