| Product Name | (S)-(-)-4-chloro 3-hydroxybutyronitrile |
| CAS No. | 127913-44-4 |
| Synonyms | (S)-(-)-4-Chloro-3-hydroxybutyronitrile; S-(-)-4-chloro-3-hydorxy butyronitrile; (3S)-4-chloro-3-hydorxybutyronitrile; (3R)-4-chloro-3-hydroxybutanenitrile; (3S)-4-chloro-3-hydroxybutanenitrile; S-(-)-4-Chloro-3-hydroxybutyronitrile; (S)-4-Chloro-3-hydroxybutyronitrile |
| InChI | InChI=1/C4H6ClNO/c5-3-4(7)1-2-6/h4,7H,1,3H2/t4-/m0/s1 |
| Molecular Formula | C4H6ClNO |
| Molecular Weight | 119.5495 |
| Density | 1.229g/cm3 |
| Boiling point | 286.2°C at 760 mmHg |
| Flash point | 126.9°C |
| Refractive index | 1.464 |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; |
| Safety | S28:After contact with skin, wash immediately with plenty of ...; S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
127913-44-4 (s)-(-)-4-chloro 3-hydroxybutyronitrile
service@apichina.com