| Product Name | (S)-(-)-2-Piperazinecarboxylic acid |
| CAS No. | 147650-70-2 |
| Synonyms | (S)-Piperazine-2-carboxylic acid; (2S)-piperazine-2-carboxylic acid; 2-(S)-Piperazine carboxylic acid |
| InChI | InChI=1/C5H10N2O2/c8-5(9)4-3-6-1-2-7-4/h4,6-7H,1-3H2,(H,8,9)/t4-/m0/s1 |
| Molecular Formula | C5H10N2O2 |
| Molecular Weight | 130.1451 |
| Density | 1.174g/cm3 |
| Boiling point | 313.6°C at 760 mmHg |
| Flash point | 143.5°C |
| Refractive index | 1.476 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
147650-70-2 (s)-(-)-2-piperazinecarboxylic acid
service@apichina.com