| Product Name | S(+)-2-phenylbutyric acid |
| CAS No. | 4286-15-1 |
| Synonyms | (S)-(+)-2-Phenylbutyric acid; (S)-(+)-alpha-Ethylphenylacetic acid; (2S)-2-phenylbutanoic acid |
| InChI | InChI=1/C10H12O2/c1-2-9(10(11)12)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H,11,12)/t9-/m0/s1 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.2011 |
| Density | 1.09g/cm3 |
| Boiling point | 272.9°C at 760 mmHg |
| Flash point | 170.2°C |
| Refractive index | 1.531 |
| Risk Codes | R22:Harmful if swallowed.; R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
4286-15-1 s(+)-2-phenylbutyric acid
service@apichina.com