| Product Name | S(-)-2-methyl-1-butylamine |
| CAS No. | 34985-37-0 |
| Synonyms | (S)-(-)-2-Methylbutylamine; (S)-(-)-1-Amino-2-methylbutane; 2-methylbutan-1-amine; (2S)-2-methylbutan-1-amine |
| InChI | InChI=1/C5H13N/c1-3-5(2)4-6/h5H,3-4,6H2,1-2H3/t5-/m0/s1 |
| Molecular Formula | C5H13N |
| Molecular Weight | 87.1634 |
| Density | 0.757g/cm3 |
| Boiling point | 92.1°C at 760 mmHg |
| Flash point | 3.3°C |
| Refractive index | 1.413 |
| Risk Codes | R11:Highly flammable.; R34:Causes burns.; R37:Irritating to respiratory system.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
34985-37-0 s(-)-2-methyl-1-butylamine
service@apichina.com