| Product Name | (S)-2-Aminononane |
| CAS No. | 13205-58-8 |
| Synonyms | (S)-(+)-2-Aminononane; (S)-1-Methyloctylamine~(2S)-Nonylamine; nonan-2-amine; (2S)-nonan-2-amine |
| InChI | InChI=1/C9H21N/c1-3-4-5-6-7-8-9(2)10/h9H,3-8,10H2,1-2H3/t9-/m0/s1 |
| Molecular Formula | C9H21N |
| Molecular Weight | 143.2697 |
| Density | 0.79g/cm3 |
| Boiling point | 191°C at 760 mmHg |
| Flash point | 69.8°C |
| Refractive index | 1.434 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
13205-58-8 (s)-2-aminononane
service@apichina.com