| Product Name | (S)-(+)-1-Methoxy-2-propylamine |
| CAS No. | 99636-32-5 |
| Synonyms | (S)-2-Amino-1-methoxypropane; (S)-1-Methoxy-2-aminopropane; (2S)-1-methoxypropan-2-amine; (2R)-1-methoxypropan-2-amine |
| InChI | InChI=1/C4H11NO/c1-4(5)3-6-2/h4H,3,5H2,1-2H3/t4-/m1/s1 |
| Molecular Formula | C4H11NO |
| Molecular Weight | 89.1362 |
| Density | 0.849g/cm3 |
| Boiling point | 93.7°C at 760 mmHg |
| Flash point | 8.9°C |
| Refractive index | 1.406 |
| Risk Codes | R11:Highly flammable.; R22:Harmful if swallowed.; R35:Causes severe burns.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
99636-32-5 (s)-(+)-1-methoxy-2-propylamine
service@apichina.com