| Product Name | (S)-1-Cyclohexylethyl isocyanate |
| CAS No. | 93470-27-0 |
| Synonyms | [(1S)-1-isocyanatoethyl]cyclohexane |
| InChI | InChI=1/C9H15NO/c1-8(10-7-11)9-5-3-2-4-6-9/h8-9H,2-6H2,1H3/t8-/m0/s1 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.2215 |
| Density | 1.02g/cm3 |
| Boiling point | 213.8°C at 760 mmHg |
| Flash point | 80.5°C |
| Refractive index | 1.514 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
93470-27-0 (s)-1-cyclohexylethyl isocyanate
service@apichina.com