| Product Name | (S)-1-(4-Bromophenyl)ethyl isocyanate |
| CAS No. | 149552-52-3 |
| Synonyms | 1-bromo-4-[(1S)-1-isocyanatoethyl]benzene; (S)-(-)-1-(4-Bromophenyl)Ethyl Isocyanate |
| InChI | InChI=1/C9H8BrNO/c1-7(11-6-12)8-2-4-9(10)5-3-8/h2-5,7H,1H3/t7-/m0/s1 |
| Molecular Formula | C9H8BrNO |
| Molecular Weight | 226.0699 |
| Density | 1.39g/cm3 |
| Boiling point | 276.3°C at 760 mmHg |
| Flash point | 120.9°C |
| Refractive index | 1.562 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
149552-52-3 (s)-1-(4-bromophenyl)ethyl isocyanate
service@apichina.com