| Product Name | (S)-1-(3-Methoxyphenyl)ethylamine |
| CAS No. | 82796-69-8 |
| Synonyms | (S)-m-Methoxy-alpha-methylbenzylamine; (1S)-1-(3-methoxyphenyl)ethanamine |
| InChI | InChI=1/C9H13NO/c1-7(10)8-4-3-5-9(6-8)11-2/h3-7H,10H2,1-2H3/t7-/m0/s1 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.2056 |
| Density | 1.003g/cm3 |
| Boiling point | 234.6°C at 760 mmHg |
| Flash point | 94.7°C |
| Refractive index | 1.522 |
| Risk Codes | R21/22:Harmful in contact with skin and if swallowed.; R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
82796-69-8 (s)-1-(3-methoxyphenyl)ethylamine
service@apichina.com