| Product Name | (S)-1,2,3,4-Tetrahydro-2-naphthylamine |
| CAS No. | 21880-87-5 |
| Synonyms | (S)-2-Amino-1,2,3,4-tetrahydronaphthalene; (S)-1-Aminotetraline; (S)-2-Aminotetralin; (1S)-1,2,3,4-tetrahydronaphthalen-1-amine; (2S)-1,2,3,4-tetrahydronaphthalen-2-amine |
| InChI | InChI=1/C10H13N/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-4,10H,5-7,11H2/t10-/m0/s1 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.2169 |
| Density | 1.024g/cm3 |
| Boiling point | 250.665°C at 760 mmHg |
| Flash point | 111.607°C |
| Refractive index | 1.561 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
21880-87-5 (s)-1,2,3,4-tetrahydro-2-naphthylamine
service@apichina.com