| Product Name | (S)-1-(1-Naphthyl)ethyl isothiocyanate |
| CAS No. | 131074-55-0 |
| Synonyms | 1-[(1S)-1-isothiocyanatoethyl]naphthalene |
| InChI | InChI=1/C13H11NS/c1-10(14-9-15)12-8-4-6-11-5-2-3-7-13(11)12/h2-8,10H,1H3/t10-/m0/s1 |
| Molecular Formula | C13H11NS |
| Molecular Weight | 213.2981 |
| Density | 1.08g/cm3 |
| Boiling point | 354.4°C at 760 mmHg |
| Flash point | 177.8°C |
| Refractive index | 1.6 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
131074-55-0 (s)-1-(1-naphthyl)ethyl isothiocyanate
service@apichina.com