| Product Name | Rhodizonic acid dihydrate |
| CAS No. | 118-76-3 |
| Synonyms | 5,6-dihydroxycyclohex-5-ene-1,2,3,4-tetraone; Rhodizonic acid; 1,2-Dihydroxy-3,4,5,6-tetraoxocyclohexene; 5,6-dihydroxycyclohex-5-ene-1,2,3,4-tetrone; 5,6-dihydroxycyclohex-5-ene-1,2,3,4-tetrone dihydrate |
| InChI | InChI=1/C6H2O6.2H2O/c7-1-2(8)4(10)6(12)5(11)3(1)9;;/h7-8H;2*1H2 |
| Molecular Formula | C6H6O8 |
| Molecular Weight | 206.107 |
| Melting point | 255-257℃ |
| Boiling point | 346.7°C at 760 mmHg |
| Flash point | 177.7°C |
| Safety | S24/25:Avoid contact with skin and eyes.; |
118-76-3 rhodizonic acid dihydrate
service@apichina.com
- Next:118-78-5 uramil
- Previous:118-75-2 p-chloranil