| Product Name | (R,S)-4-Pentyn-2-ol |
| CAS No. | 2117-11-5 |
| Synonyms | 4-Pentyn-2-ol; pent-4-yn-2-ol |
| InChI | InChI=1/C5H8O/c1-3-4-5(2)6/h1,5-6H,4H2,2H3 |
| Molecular Formula | C5H8O |
| Molecular Weight | 84.1164 |
| Density | 0.907g/cm3 |
| Boiling point | 126.5°C at 760 mmHg |
| Flash point | 37.2°C |
| Refractive index | 1.442 |
| Risk Codes | R10:Flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
2117-11-5 (r,s)-4-pentyn-2-ol
service@apichina.com