| Product Name | (R)-N-Phthaloyl-2-aminobut-3-en-1-ol |
| CAS No. | 174810-06-1 |
| Synonyms | (R)-2-Phthalimido-3-buten-1-ol; 2-[(1R)-1-(hydroxymethyl)prop-2-en-1-yl]-1H-isoindole-1,3(2H)-dione |
| InChI | InChI=1/C12H11NO3/c1-2-8(7-14)13-11(15)9-5-3-4-6-10(9)12(13)16/h2-6,8,14H,1,7H2/t8-/m1/s1 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.2206 |
| Density | 1.326g/cm3 |
| Melting point | 62.2℃ |
| Boiling point | 382.2°C at 760 mmHg |
| Flash point | 184.9°C |
| Refractive index | 1.618 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
174810-06-1 (r)-n-phthaloyl-2-aminobut-3-en-1-ol
service@apichina.com