| Product Name | (R)-N-Methyl-1-phenyl-2-(1-pyrrolidino)ethylamine |
| CAS No. | 136329-39-0 |
| Synonyms | (R)-(-)-N-Methyl-1-phenyl-2-(1-pyrrolidino)ethylamine; N-methyl-1-phenyl-2-pyrrolidin-1-ylethanamine |
| InChI | InChI=1/C13H20N2/c1-14-13(11-15-9-5-6-10-15)12-7-3-2-4-8-12/h2-4,7-8,13-14H,5-6,9-11H2,1H3 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.3113 |
| Density | 1g/cm3 |
| Boiling point | 296.1°C at 760 mmHg |
| Flash point | 113.1°C |
| Refractive index | 1.54 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
136329-39-0 (r)-n-methyl-1-phenyl-2-(1-pyrrolidino)ethylamine
service@apichina.com