| Product Name | (R)-N-(2-Propyl)-1-phenylethylamine hydrochloride |
| CAS No. | 128593-72-6 |
| Synonyms | (R)-N-Isopropyl-1-phenylethylamine hydrochloride; N-[(1R)-1-phenylethyl]propan-2-amine |
| InChI | InChI=1/C11H17N/c1-9(2)12-10(3)11-7-5-4-6-8-11/h4-10,12H,1-3H3/t10-/m1/s1 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.2594 |
| Density | 0.898g/cm3 |
| Boiling point | 215.3°C at 760 mmHg |
| Flash point | 76.7°C |
| Refractive index | 1.497 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
128593-72-6 (r)-n-(2-propyl)-1-phenylethylamine hydrochloride
service@apichina.com