| Product Name | (R)-(+)-beta-Hydroxy-gamma-butyrolactone |
| CAS No. | 58081-05-3 |
| Synonyms | (4R)-4-hydroxydihydrofuran-2(3H)-one; (R)-(+)-3-Hydroxybutyrolactone |
| InChI | InChI=1/C4H6O3/c5-3-1-4(6)7-2-3/h3,5H,1-2H2/t3-/m1/s1 |
| Molecular Formula | C4H6O3 |
| Molecular Weight | 102.0886 |
| Density | 1.393g/cm3 |
| Boiling point | 310.3°C at 760 mmHg |
| Flash point | 157.1°C |
| Refractive index | 1.506 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
58081-05-3 (r)-(+)-beta-hydroxy-gamma-butyrolactone
service@apichina.com