| Product Name | (R)-5-Phthalimido-2-bromovaleric acid |
| CAS No. | 179090-36-9 |
| Synonyms | (2R)-2-bromo-5-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)pentanoate |
| InChI | InChI=1/C13H12BrNO4/c14-10(13(18)19)6-3-7-15-11(16)8-4-1-2-5-9(8)12(15)17/h1-2,4-5,10H,3,6-7H2,(H,18,19)/p-1/t10-/m1/s1 |
| Molecular Formula | C13H11BrNO4 |
| Molecular Weight | 325.1353 |
| Boiling point | 483.4°C at 760 mmHg |
| Flash point | 246.2°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
179090-36-9 (r)-5-phthalimido-2-bromovaleric acid
service@apichina.com