| Product Name | (R)-(+)-2-(Phenylcarbamoyloxy)propionic acid |
| CAS No. | 145987-00-4 |
| Synonyms | (R)-(+)-Browns; (2R)-2-[(phenylcarbamoyl)oxy]propanoic acid; (R)-(+)-2-(Phenylcarbamoyloxy)Propionic Acid |
| InChI | InChI=1/C10H11NO4/c1-7(9(12)13)15-10(14)11-8-5-3-2-4-6-8/h2-7H,1H3,(H,11,14)(H,12,13)/t7-/m1/s1 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.1986 |
| Density | 1.333g/cm3 |
| Boiling point | 324.7°C at 760 mmHg |
| Flash point | 150.2°C |
| Refractive index | 1.591 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
145987-00-4 (r)-(+)-2-(phenylcarbamoyloxy)propionic acid
service@apichina.com