| Product Name | (R)-(+)-2-Benzyloxypropionic acid |
| CAS No. | 100836-85-9 |
| Synonyms | O-Benzyl-D-lactic acid; (2R)-2-(benzyloxy)propanoic acid; (R)-(+)-2-Benzyloxypropanoic acid |
| InChI | InChI=1/C10H12O3/c1-8(10(11)12)13-7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,11,12)/t8-/m1/s1 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.2005 |
| Density | 1.15g/cm3 |
| Boiling point | 328.2°C at 760 mmHg |
| Flash point | 130.4°C |
| Refractive index | 1.529 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
100836-85-9 (r)-(+)-2-benzyloxypropionic acid
service@apichina.com