| Product Name | (R)-(-)-2-(Anilinomethyl)pyrrolidine |
| CAS No. | 68295-45-4 |
| Synonyms | N-[(2R)-pyrrolidin-2-ylmethyl]aniline |
| InChI | InChI=1/C11H16N2/c1-2-5-10(6-3-1)13-9-11-7-4-8-12-11/h1-3,5-6,11-13H,4,7-9H2/t11-/m1/s1 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.2581 |
| Density | 1.038g/cm3 |
| Boiling point | 311°C at 760 mmHg |
| Flash point | 184.3°C |
| Refractive index | 1.57 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
68295-45-4 (r)-(-)-2-(anilinomethyl)pyrrolidine
service@apichina.com