| Product Name | (R)-2-Amino-6-methylheptane |
| CAS No. | 70419-11-3 |
| Synonyms | (2R)-6-Methyl-heptylamine; (R)-1,5-Dimethylhexylamine; (2R)-6-methylheptan-2-amine |
| InChI | InChI=1/C8H19N/c1-7(2)5-4-6-8(3)9/h7-8H,4-6,9H2,1-3H3/t8-/m1/s1 |
| Molecular Formula | C8H19N |
| Molecular Weight | 129.2432 |
| Density | 0.783g/cm3 |
| Boiling point | 155°C at 760 mmHg |
| Flash point | 48.9°C |
| Refractive index | 1.429 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R10:Flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
70419-11-3 (r)-2-amino-6-methylheptane
service@apichina.com