| Product Name | (R)-1-Cyclohexylethyl isothiocyanate |
| CAS No. | 196402-21-8 |
| Synonyms | [(1R)-1-isothiocyanatoethyl]cyclohexane |
| InChI | InChI=1/C9H15NS/c1-8(10-7-11)9-5-3-2-4-6-9/h8-9H,2-6H2,1H3/t8-/m1/s1 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.2871 |
| Density | 1.04g/cm3 |
| Boiling point | 262.2°C at 760 mmHg |
| Flash point | 113.3°C |
| Refractive index | 1.553 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
196402-21-8 (r)-1-cyclohexylethyl isothiocyanate
service@apichina.com