| Product Name | (R)-(+)-1-(4-Bromophenyl)ethylamine hydrochloride |
| CAS No. | 64265-77-6 |
| Synonyms | (1R)-1-(4-bromophenyl)ethanamine hydrochloride |
| InChI | InChI=1/C8H10BrN.ClH/c1-6(10)7-2-4-8(9)5-3-7;/h2-6H,10H2,1H3;1H/t6-;/m1./s1 |
| Molecular Formula | C8H11BrClN |
| Molecular Weight | 236.5366 |
| Melting point | 235℃ |
| Boiling point | 258.9°C at 760 mmHg |
| Flash point | 110.4°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
64265-77-6 (r)-(+)-1-(4-bromophenyl)ethylamine hydrochloride
service@apichina.com