| Product Name | R(-)-1-(1-naphthyl)ethyl isocyanate stab. |
| CAS No. | 42340-98-7 |
| Synonyms | (R)-(-)-1-(1-Naphthyl)ethyl isocyanate; Isocyanic acid (R)-(-)-1-(1-naphthyl)ethyl ester; 1-[(1R)-1-isocyanatoethyl]naphthalene |
| InChI | InChI=1/C13H11NO/c1-10(14-9-15)12-8-4-6-11-5-2-3-7-13(11)12/h2-8,10H,1H3/t10-/m1/s1 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.2325 |
| Density | 1.06g/cm3 |
| Boiling point | 333.5°C at 760 mmHg |
| Flash point | 93.3°C |
| Refractive index | 1.57 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
42340-98-7 r(-)-1-(1-naphthyl)ethyl isocyanate stab.
service@apichina.com