| Product Name | quinine dihydrochloride |
| CAS No. | 60-93-5 |
| Synonyms | Quinine Dihydochloride; (8alpha,9R)-6'-methoxycinchonan-9-ol dihydrochloride |
| InChI | InChI=1/C20H24N2O2.2ClH/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;;/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;2*1H/t13-,14-,19-,20+;;/m0../s1 |
| Molecular Formula | C20H26Cl2N2O2 |
| Molecular Weight | 397.3386 |
| Boiling point | 495.9°C at 760 mmHg |
| Flash point | 253.7°C |
| Risk Codes | R22:Harmful if swallowed.; R42/43:May cause sensitization by inhalation and skin contact.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
60-93-5 quinine dihydrochloride
service@apichina.com