| Product Name | quin 2 |
| CAS No. | 83014-44-2 |
| Synonyms | Quin-2, free acid; Quin-2; {[2-({8-[bis(carboxymethyl)amino]-6-methoxyquinolin-2-yl}methoxy)-4-methylphenyl](carboxymethyl)amino}acetic acid |
| InChI | InChI=1/C26H27N3O10/c1-15-3-6-19(28(10-22(30)31)11-23(32)33)21(7-15)39-14-17-5-4-16-8-18(38-2)9-20(26(16)27-17)29(12-24(34)35)13-25(36)37/h3-9H,10-14H2,1-2H3,(H,30,31)(H,32,33)(H,34,35)(H,36,37) |
| Molecular Formula | C26H27N3O10 |
| Molecular Weight | 541.5067 |
| Density | 1.494g/cm3 |
| Melting point | 164-166℃ |
| Boiling point | 831.6°C at 760 mmHg |
| Flash point | 456.7°C |
| Refractive index | 1.688 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
83014-44-2 quin 2
service@apichina.com