| Product Name | Pyronin Y |
| CAS No. | 92-32-0 |
| Synonyms | C.I. 45005; Pyronine; Pyronin G; PYRONINE G; pyronin Y molecular biology; Pyronin Y, CI 45005; Pyronine Y; N-[6-(dimethylamino)-3H-xanthen-3-ylidene]-N-methylmethanaminium chloride |
| InChI | InChI=1/C17H19N2O.ClH/c1-18(2)14-7-5-12-9-13-6-8-15(19(3)4)11-17(13)20-16(12)10-14;/h5-11H,1-4H3;1H/q+1;/p-1 |
| Molecular Formula | C17H19ClN2O |
| Molecular Weight | 302.7986 |
| Melting point | 250-260℃ |
| Hazard Symbols | |
| Safety | S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
92-32-0 pyronin y
service@apichina.com