| Product Name | Pyrithyldione |
| CAS No. | 77-04-3 |
| Synonyms | 3,3-Diethyl-2,4(1H,3H)-pyridinedione; 3,3-diethylpyridine-2,4(1H,3H)-dione |
| InChI | InChI=1/C9H13NO2/c1-3-9(4-2)7(11)5-6-10-8(9)12/h5-6H,3-4H2,1-2H3,(H,10,12) |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.205 |
| Density | 1.029g/cm3 |
| Boiling point | 330.2°C at 760 mmHg |
| Flash point | 147.8°C |
| Refractive index | 1.464 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21:Harmful by inhalation and in contact with skin.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; |
77-04-3 pyrithyldione
service@apichina.com