| Product Name | Pyrido[2,3-b]pyrazine |
| CAS No. | 322-46-3 |
| Synonyms | 1,4,5-Triazanaphthalene; Pyrido(2,3-b)pyrazine; Pyridopyrazine |
| InChI | InChI=1/C7H5N3/c1-2-6-7(9-3-1)10-5-4-8-6/h1-5H |
| Molecular Formula | C7H5N3 |
| Molecular Weight | 131.1347 |
| Density | 1.27g/cm3 |
| Melting point | 139-143℃ |
| Boiling point | 253.9°C at 760 mmHg |
| Flash point | 115.9°C |
| Refractive index | 1.665 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
322-46-3 pyrido[2,3-b]pyrazine
service@apichina.com