| Product Name | propionic acid, compound with N-[3-(dimethylamino)propyl]dodecanamide (1:1) |
| CAS No. | 67801-62-1 |
| Synonyms | Propanoic acid, compd. with N-(3-(dimethylamino)propyl)dodecanamide (1:1); N,N-Dimethyl-N-(3-dodecanamidopropyl)amine, propionic acid salt; N,N-Dimethyl-N-(3-laurylamidopropyl)amine monopropionic acid salt; Propionic acid, compound with N-(3-(dimethylamino)propyl)dodecanamide (1:1); propanoic acid - N-[3-(dimethylamino)propyl]dodecanamide (1:1) |
| InChI | InChI=1/C17H36N2O.C3H6O2/c1-4-5-6-7-8-9-10-11-12-14-17(20)18-15-13-16-19(2)3;1-2-3(4)5/h4-16H2,1-3H3,(H,18,20);2H2,1H3,(H,4,5) |
| Molecular Formula | C20H42N2O3 |
| Molecular Weight | 358.5591 |
| Boiling point | 418.9°C at 760 mmHg |
| Flash point | 207.1°C |
67801-62-1 propionic acid, compound with n-[3-(dimethylamino)propyl]dodecanamide (1:1)
service@apichina.com