| Product Name | Propargylpropionate(Propionicacidpropargylester) |
| CAS No. | 1932-92-9 |
| Synonyms | Propargyl propionate (Propionic acid propargyl ester); Propargyl propionate; Propionic acid propargyl ester; prop-2-yn-1-yl propanoate |
| InChI | InChI=1/C6H8O2/c1-3-5-8-6(7)4-2/h1H,4-5H2,2H3 |
| Molecular Formula | C6H8O2 |
| Molecular Weight | 112.1265 |
| Density | 0.976g/cm3 |
| Boiling point | 146.4°C at 760 mmHg |
| Flash point | 42.1°C |
| Refractive index | 1.426 |
| Risk Codes | R10:Flammable.; R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S23:Do not inhale gas/fumes/vapour/spray.; S36/37:Wear suitable protective clothing and gloves.; |
1932-92-9 propargylpropionate(propionicacidpropargylester)
service@apichina.com