| Product Name | Propargylacetate(Aceticacidpropargylester) |
| CAS No. | 627-09-8 |
| Synonyms | Propargyl acetate (Acetic acid propargyl ester); Propargyl acetate; Acetic acid propargyl ester~2-Propyn-1-yl acetate; prop-2-ynyl acetate |
| InChI | InChI=1/C5H6O2/c1-3-4-7-5(2)6/h1H,4H2,2H3 |
| Molecular Formula | C5H6O2 |
| Molecular Weight | 98.0999 |
| Density | 0.997g/cm3 |
| Boiling point | 122.4°C at 760 mmHg |
| Flash point | 28.3°C |
| Refractive index | 1.418 |
| Risk Codes | R10:Flammable.; R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S36/37:Wear suitable protective clothing and gloves.; |
627-09-8 propargylacetate(aceticacidpropargylester)
service@apichina.com