| Product Name | Propargyl methacrylate |
| CAS No. | 13861-22-8 |
| Synonyms | Methacrylic acid propargyl ester~2-Propyn-1-yl 2-methylpropenoate; prop-2-yn-1-yl 2-methylprop-2-enoate |
| InChI | InChI=1/C7H8O2/c1-4-5-9-7(8)6(2)3/h1H,2,5H2,3H3 |
| Molecular Formula | C7H8O2 |
| Molecular Weight | 124.1372 |
| Density | 0.983g/cm3 |
| Boiling point | 148.4°C at 760 mmHg |
| Flash point | 43.2°C |
| Refractive index | 1.445 |
| Risk Codes | R10:Flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S28:After contact with skin, wash immediately with plenty of ...; |
13861-22-8 propargyl methacrylate
service@apichina.com