| Product Name | Propanedioyl dihydrazide |
| CAS No. | 3815-86-9 |
| Synonyms | Malonic dihydrazide; Malconic acid dihydrazide; propanedihydrazide |
| InChI | InChI=1/C3H8N4O2/c4-6-2(8)1-3(9)7-5/h1,4-5H2,(H,6,8)(H,7,9) |
| Molecular Formula | C3H8N4O2 |
| Molecular Weight | 132.1212 |
| Density | 1.358g/cm3 |
| Boiling point | 554°C at 760 mmHg |
| Flash point | 288.8°C |
| Refractive index | 1.534 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
3815-86-9 propanedioyl dihydrazide
service@apichina.com