| Product Name | Primuletin |
| CAS No. | 491-78-1 |
| Synonyms | 5-Hydroxyflavone; 5-Hydroxy-2-phenylchromone; 5-hydroxy-2-phenyl-4H-chromen-4-one |
| InChI | InChI=1/C15H10O3/c16-11-7-4-8-13-15(11)12(17)9-14(18-13)10-5-2-1-3-6-10/h1-9,16H |
| Molecular Formula | C15H10O3 |
| Molecular Weight | 238.2381 |
| Density | 1.34g/cm3 |
| Boiling point | 425°C at 760 mmHg |
| Flash point | 165.4°C |
| Refractive index | 1.666 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
491-78-1 primuletin
service@apichina.com