| Product Name | Potassium triethylborohydride |
| CAS No. | 22560-21-0 |
| Synonyms | potassium triethylhydroborate; potassium triethyl(hydrido)borate(1-); Potassium hydrotriethylborate |
| InChI | InChI=1/C6H16B.K/c1-4-7(5-2)6-3;/h7H,4-6H2,1-3H3;/q-1;+1 |
| Molecular Formula | C6H16BK |
| Molecular Weight | 138.1005 |
| Hazard Symbols |  F:Highly flammable;  C:Corrosive; |
| Risk Codes | R11:Highly flammable.; R15:Contact with water liberates highly flammable gases.; R19:May form explosive peroxides.; R34:Causes burns.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S25:Avoid contact with eyes.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; S7/8:Keep container tightly closed and dry.; |
22560-21-0 potassium triethylborohydride
service@apichina.com