| Product Name | Potassium carbonate |
| CAS No. | 584-08-7 |
| Synonyms | Potassium carbonate anhydrous; Potassium carbonate hemihydrate; Potassiumcarbonate; Dipotassium carbonate; Carbonic acid, dipotassium salt; Carbonate Of Potash; Salt of tartar; alt of wormwood; Pearl ash; Potassium carbonate,anhydrous; Heavy potassium carbonate |
| InChI | InChI=1/CH2O3.2K.2H/c2-1(3)4;;;;/h(H2,2,3,4);;;;/p-2/rCH2O3.2HK/c2-1(3)4;;/h(H2,2,3,4);2*1H/p-2 |
| Molecular Formula | K2CO3 |
| Molecular Weight | 138.2066 |
| Melting point | 891℃ |
| Water solubility | 1120 g/L (20℃) |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:; R36/37/38:; |
| Safety | S26:; S37/39:; |
584-08-7 potassium carbonate
service@apichina.com