| Product Name | Potassium acrylate |
| CAS No. | 10192-85-5 |
| Synonyms | PotassiumAcrylateinmethanol; Potassiumacrylate; Acrylic acid potassium salt; 2-Propenoic acid, potassium salt; prop-2-enoic acid; potassium prop-2-enoate |
| InChI | InChI=1/C3H4O2.K/c1-2-3(4)5;/h2H,1H2,(H,4,5);/q;+1/p-1 |
| Molecular Formula | C3H3KO2 |
| Molecular Weight | 110.153 |
| Melting point | 194℃ |
| Boiling point | 141°C at 760 mmHg |
| Flash point | 61.6°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S28:After contact with skin, wash immediately with plenty of ...; |
10192-85-5 potassium acrylate
service@apichina.com