| Product Name | poly(vinylidene chloride-co-methyl acrylate) |
| CAS No. | 25038-72-6 |
| Synonyms | 2-Propenoic acid, methyl ester, polymer with 1,1-dichloroethene; 1,1-Dichloroethene, methyl 2-propenoate polymer; 1,1-Dichloroethene, polymer with methyl 2-propenoate; Vinylidene chloride, methyl acrylate polymer; methyl prop-2-enoate - 1,1-dichloroethene (1:1) |
| InChI | InChI=1/C4H6O2.C2H2Cl2/c1-3-4(5)6-2;1-2(3)4/h3H,1H2,2H3;1H2 |
| Molecular Formula | C6H8Cl2O2 |
| Molecular Weight | 183.0325 |
| Melting point | 152℃ |
| Boiling point | 80.2°C at 760 mmHg |
| Flash point | 6.7°C |
25038-72-6 poly(vinylidene chloride-co-methyl acrylate)
service@apichina.com