| Product Name | Poly(styrene) |
| CAS No. | 9003-53-6 |
| Synonyms | Polystyrene; polystyrene standard 4000000; polystyrene standard 2000000; polystyrene standard 300000; polystyrene standard 1000000; polystyrene standard 700000; polystyrene standard 650000; polystyrene standard 2200000 certi-fied acc. to din; polystyrene standard 500000; polystyrene standard 8000000; Polystyrene (General Purpose Grade); Polystyrene, dicarboxy terminated; Polystyrene, methacrylate terminated solution; Styrene Resin (High M.Wt.); Styrene Latex; Styrene Resin (Low M.Wt.); Styrene Resin (Med.M.Wt.); Styrene-divinylbenzene copolymer (20% cross-linked); Polystyrene2% crosslinked with vinylbenzene; EPS; Expandable Polystyrene |
| InChI | InChI=1/C9H8/c1-8(2)9-6-4-3-5-7-9/h1-8H |
| Molecular Formula | C8H8 |
| Molecular Weight | 104.1491 |
| Density | 1.047 |
| Boiling point | 212℃ |
| Water solubility | insoluble |
| Refractive index | 1.5916 |
| Hazard Symbols |  Xi:; |
| Risk Codes | 41:; |
| Safety | S24/25:; |
9003-53-6 poly(styrene)
service@apichina.com