| Product Name | Poly(iso-octyl acrylate) (in Toluene,Unit weight does not include wt. of solvent) |
| CAS No. | 9036-63-9 |
| Synonyms | 2-Propenoic acid, isooctyl ester, homopolymer; CCRIS 4353; Isooctyl 2-propenoate, homopolymer; Isooctyl acrylate homopolymer; Isooctyl acrylate polymer; 6-methylheptyl propanoate |
| InChI | InChI=1/C11H22O2/c1-4-11(12)13-9-7-5-6-8-10(2)3/h10H,4-9H2,1-3H3 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.2912 |
| Density | 0.87g/cm3 |
| Boiling point | 214.2°C at 760 mmHg |
| Flash point | 82.9°C |
| Refractive index | 1.425 |
9036-63-9 poly(iso-octyl acrylate) (in toluene,unit weight does not include wt. of solvent)
service@apichina.com