Product Name | Poly(2-hydroxypropyl methacrylate) |
CAS No. | 25703-79-1 |
Synonyms | 2-Hydroxypropyl methacrylate homopolymer; 2-Propenoic acid, 2-methyl-, 2-hydroxypropyl ester, homopolymer; 2-hydroxypropyl 2-methylprop-2-enoate |
InChI | InChI=1/C7H12O3/c1-5(2)7(9)10-4-6(3)8/h6,8H,1,4H2,2-3H3 |
Molecular Formula | C7H12O3 |
Molecular Weight | 144.1684 |
Density | 1.027g/cm3 |
Boiling point | 218.8°C at 760 mmHg |
Flash point | 86.9°C |
Refractive index | 1.444 |
Safety | S24/25:Avoid contact with skin and eyes.; |
25703-79-1 poly(2-hydroxypropyl methacrylate)
service@apichina.com