| Product Name | Plumbagin |
| CAS No. | 481-42-5 |
| Synonyms | 5-Hydroxy-2-methyl-1,4-naphthoquinone; Plumbagin,95%; Plumbagin from Plumbago indica; 5-hydroxy-2-methylnaphthalene-1,4-dione |
| InChI | InChI=1/C11H8O3/c1-6-5-9(13)10-7(11(6)14)3-2-4-8(10)12/h2-5,12H,1H3 |
| Molecular Formula | C11H8O3 |
| Molecular Weight | 188.1794 |
| Density | 1.354g/cm3 |
| Melting point | 75-78℃ |
| Boiling point | 383.9°C at 760 mmHg |
| Flash point | 200.2°C |
| Refractive index | 1.63 |
| Hazard Symbols |  T:Toxic; |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S24/25:Avoid contact with skin and eyes.; |
481-42-5 plumbagin
service@apichina.com