| Product Name | Phthalimidoacetaldehyde diethyl acetal |
| CAS No. | 78902-09-7 |
| Synonyms | LABOTEST-BB LT00454122; 2-PHTHALIMIDOACETALDEHYDE DIETHYL ACETAL; N-(2,2-DIETHOXYETHYL)PHTHALIMIDE; 2-(2,2-diethoxyethyl)-1H-isoindole-1,3(2H)-dione; 2-(Phthalimido)acetaldehyde diethylacetal; 2-(2,2-Diethoxyethyl)isoindoline-1,3-dione |
| InChI | InChI=1/C14H17NO4/c1-3-18-12(19-4-2)9-15-13(16)10-7-5-6-8-11(10)14(15)17/h5-8,12H,3-4,9H2,1-2H3 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.2891 |
| Density | 1.2g/cm3 |
| Melting point | 72-74℃ |
| Boiling point | 372.3°C at 760 mmHg |
| Flash point | 179°C |
| Refractive index | 1.541 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
78902-09-7 phthalimidoacetaldehyde diethyl acetal
service@apichina.com