| Product Name | Phthalide-3-acetic acid |
| CAS No. | 4743-58-2 |
| Synonyms | Phthalidineacetic acid; 1(3H)-Isobenzofuranone-3-acetic acid; (3-oxo-1,3-dihydro-2-benzofuran-1-yl)acetic acid |
| InChI | InChI=1/C10H8O4/c11-9(12)5-8-6-3-1-2-4-7(6)10(13)14-8/h1-4,8H,5H2,(H,11,12) |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.1681 |
| Density | 1.389g/cm3 |
| Boiling point | 440.1°C at 760 mmHg |
| Flash point | 184.1°C |
| Refractive index | 1.586 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4743-58-2 phthalide-3-acetic acid
service@apichina.com