| Product Name | phthalic acid, diester with lactonitrile |
| CAS No. | 6380-63-8 |
| Synonyms | 1,2-Benzenedicarboxylic acid, 1,2-bis(1-cyanoethyl) ester; Bis(1-cyanoethyl) phthalate; Bis(1-cyanoethyl)phthalate; 1,2-Benzenedicarboxylic acid, bis(1-cyanoethyl) ester; Phthalic acid, diester with lactonitrile; bis(1-cyanoethyl) benzene-1,2-dicarboxylate |
| InChI | InChI=1/C14H12N2O4/c1-9(7-15)19-13(17)11-5-3-4-6-12(11)14(18)20-10(2)8-16/h3-6,9-10H,1-2H3 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.2561 |
| Density | 1.244g/cm3 |
| Boiling point | 467.7°C at 760 mmHg |
| Flash point | 203.7°C |
| Refractive index | 1.534 |
6380-63-8 phthalic acid, diester with lactonitrile
service@apichina.com